Systematic / IUPAC Name:
ID: Reference12923
Other Names: 98_Me-CHL-8
Formula: C18H15NO2
(2E)-3-(4-Hydroxyphenyl)-1-(1-methyl-1H-indol-3-yl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1397 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2023 2:43:26 PM |
| InChI | InChI=1S/C18H15NO2/c1-19-12-16(15-4-2-3-5-17(15)19)18(21)11-8-13-6-9-14(20)10-7-13/h2-12,20H,1H3/b11-8+ |
| InChI Key | ARNRFJAVGZHFBX-DHZHZOJOSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 98_Me-CHL-8 |