Systematic / IUPAC Name: 4-Acetamido-N-[[(1S,4S,6S)-4-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide
ID: Reference12952
Other Names: NAT28-417646
Formula: C29H33FN4O3
4-Acetamido-N-{[(1S,4S,6S)-4-{[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-6-isopropyl-3-methyl-2-cyclohexen-1-yl]methyl}benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2688 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/5/2024 10:19:04 AM |
| InChI | InChI=1S/C29H33FN4O3/c1-17(2)25-14-21(15-27-33-34-29(37-27)24-7-5-6-8-26(24)30)18(3)13-22(25)16-31-28(36)20-9-11-23(12-10-20)32-19(4)35/h5-13,17,21-22,25H,14-16H2,1-4H3,(H,31,36)(H,32,35)/t21-,22-,25-/m0/s1 |
| InChI Key | XRLCVSBIEYLRNT-HWBMXIPRSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CC=CC=C3F)C(C)C)CNC(=O)C4=CC=C(C=C4)NC(=O)C |
| CAS | |
| Splash | |
| Other Names | NAT28-417646 |