Systematic / IUPAC Name: (4-Hydroxy-3-methoxyphenyl)acetic acid
ID: Reference1296
Other Names:
Benzeneacetic acid, 4-hydroxy-3-methoxy-;
3-Methoxy-4-hydroxyphenylacetic acid;
Acetic acid, (4-hydroxy-3-methoxyphenyl)-;
3-Methoxy-4-hydroxyphenylacetate;
Vanillacetic acid
; more
Formula: C9H10O4
Class: Endogenous Metabolites
Homovanillic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 1481 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 10:24:16 AM |
| InChI | InChI=1S/C9H10O4/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4,10H,5H2,1H3,(H,11,12) |
| InChI Key | QRMZSPFSDQBLIX-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=CC(=C1)CC(=O)O)O |
| CAS | 306081 |
| Splash | |
| Other Names |
Benzeneacetic acid, 4-hydroxy-3-methoxy-; 3-Methoxy-4-hydroxyphenylacetic acid; Acetic acid, (4-hydroxy-3-methoxyphenyl)-; 3-Methoxy-4-hydroxyphenylacetate; Vanillacetic acid; 4-Hydroxy-3-methoxybenzeneacetate; Homovanilic acid |
| ChemIDPlus | 000306081 |
| Wikipedia | Homovanillic acid |
| PubChem | 1738 |
| KEGG | C05582; C06045 |
| ChemSpider | 1675 |
| HMDb | HMDB00118 |
| ChEBI | CHEBI:545959 |
| ChEMBL | CHEMBL1562 |