Systematic / IUPAC Name: (3R,5S)-1-Cyclohexyl-5-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol
ID: Reference12961
Other Names: NAT18-349700
Formula: C18H22N4O4
(3R,5S)-1-Cyclohexyl-5-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 310 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/5/2024 10:30:01 AM |
| InChI | InChI=1S/C18H22N4O4/c23-15-10-16(21(11-15)13-6-2-1-3-7-13)18-19-17(20-26-18)12-5-4-8-14(9-12)22(24)25/h4-5,8-9,13,15-16,23H,1-3,6-7,10-11H2/t15-,16+/m1/s1 |
| InChI Key | MRQADEITMJAGGK-CVEARBPZSA-N |
| Canonical SMILES | C1CCC(CC1)N2CC(CC2C3=NC(=NO3)C4=CC(=CC=C4)[N+](=O)[O-])O |
| CAS | |
| Splash | |
| Other Names | NAT18-349700 |