Systematic / IUPAC Name: N-[4-[(R)-[(3R)-4-Benzyl-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-2-methoxyacetamide
ID: Reference12963
Other Names: NAT36-504349
Formula: C21H24N2O5
N-{4-[(R)-[(3R)-4-Benzyl-5-oxo-3-morpholinyl](hydroxy)methyl]phenyl}-2-methoxyacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1942 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/9/2024 1:32:07 PM |
| InChI | InChI=1S/C21H24N2O5/c1-27-13-19(24)22-17-9-7-16(8-10-17)21(26)18-12-28-14-20(25)23(18)11-15-5-3-2-4-6-15/h2-10,18,21,26H,11-14H2,1H3,(H,22,24)/t18-,21-/m1/s1 |
| InChI Key | VPGKUQCWGDPBDD-WIYYLYMNSA-N |
| Canonical SMILES | COCC(=O)NC1=CC=C(C=C1)C(C2COCC(=O)N2CC3=CC=CC=C3)O |
| CAS | |
| Splash | |
| Other Names | NAT36-504349 |