Systematic / IUPAC Name: (4aR,7aS)-6-(1H-Indol-3-ylmethyl)-4-[(4-methoxyphenyl)methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one
ID: Reference12965
Other Names: NAT37-483740
Formula: C23H25N3O3
(4aR,7aS)-6-(1H-Indol-3-ylmethyl)-4-(4-methoxybenzyl)hexahydropyrrolo[3,4-b][1,4]oxazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 855 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/9/2024 1:37:17 PM |
| InChI | InChI=1S/C23H25N3O3/c1-28-18-8-6-16(7-9-18)11-26-21-13-25(14-22(21)29-15-23(26)27)12-17-10-24-20-5-3-2-4-19(17)20/h2-10,21-22,24H,11-15H2,1H3/t21-,22+/m1/s1 |
| InChI Key | NFKHAJOVXWEZKU-YADHBBJMSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CN2C3CN(CC3OCC2=O)CC4=CNC5=CC=CC=C54 |
| CAS | |
| Splash | |
| Other Names | NAT37-483740 |