Systematic / IUPAC Name: 3-[[5-(4-Fluorophenyl)-1,2-oxazol-3-yl]methyl]-N-(2-methylpropyl)oxetan-3-amine
ID: Reference12966
Other Names: NAT39-500090
Formula: C17H21FN2O2
3-{[5-(4-Fluorophenyl)-1,2-oxazol-3-yl]methyl}-N-isobutyl-3-oxetanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 695 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/9/2024 1:39:02 PM |
| InChI | InChI=1S/C17H21FN2O2/c1-12(2)9-19-17(10-21-11-17)8-15-7-16(22-20-15)13-3-5-14(18)6-4-13/h3-7,12,19H,8-11H2,1-2H3 |
| InChI Key | MAPWPKYOFIYMNQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CNC1(COC1)CC2=NOC(=C2)C3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names | NAT39-500090 |