Systematic / IUPAC Name:
ID: Reference12975
Other Names: NAT26-504000
Formula: C23H36N2O2
N-[(1S,3S)-3-{[5-(Cyclohexylmethyl)-1,2-oxazol-3-yl]methyl}-2,2-dimethylcyclobutyl]cyclopentanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 913 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/23/2024 3:41:20 PM |
| InChI | InChI=1S/C23H36N2O2/c1-23(2)18(14-21(23)24-22(26)17-10-6-7-11-17)13-19-15-20(27-25-19)12-16-8-4-3-5-9-16/h15-18,21H,3-14H2,1-2H3,(H,24,26)/t18-,21+/m1/s1 |
| InChI Key | JMDDOPRJYJSLFF-NQIIRXRSSA-N |
| Canonical SMILES | CC1(C(CC1NC(=O)C2CCCC2)CC3=NOC(=C3)CC4CCCCC4)C |
| CAS | |
| Splash | |
| Other Names | NAT26-504000 |