Systematic / IUPAC Name: (3S)-N-(2,4-Difluorophenyl)-3-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]pyrrolidine-1-carboxamide
ID: Reference12979
Other Names: NAT31-467023
Formula: C20H18F2N4O3
(3S)-N-(2,4-Difluorophenyl)-3-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1-pyrrolidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 959 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/24/2024 8:59:49 AM |
| InChI | InChI=1S/C20H18F2N4O3/c1-28-15-5-2-12(3-6-15)18-24-25-19(29-18)13-8-9-26(11-13)20(27)23-17-7-4-14(21)10-16(17)22/h2-7,10,13H,8-9,11H2,1H3,(H,23,27)/t13-/m0/s1 |
| InChI Key | NISYVMZLAZGMAM-ZDUSSCGKSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C2=NN=C(O2)C3CCN(C3)C(=O)NC4=C(C=C(C=C4)F)F |
| CAS | |
| Splash | |
| Other Names | NAT31-467023 |