Systematic / IUPAC Name: 4-Methoxy-N-[5-[5-[(2S)-1-methylpyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-yl]benzamide
ID: Reference12987
Other Names: NAT18-437656
Formula: C20H21N5O3
4-Methoxy-N-(5-{5-[(2S)-1-methyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-pyridinyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1253 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/30/2024 5:44:43 PM |
| InChI | InChI=1S/C20H21N5O3/c1-25-11-3-4-16(25)20-23-18(24-28-20)14-7-10-17(21-12-14)22-19(26)13-5-8-15(27-2)9-6-13/h5-10,12,16H,3-4,11H2,1-2H3,(H,21,22,26)/t16-/m0/s1 |
| InChI Key | YDNWQUMGBATCDP-INIZCTEOSA-N |
| Canonical SMILES | CN1CCCC1C2=NC(=NO2)C3=CN=C(C=C3)NC(=O)C4=CC=C(C=C4)OC |
| CAS | |
| Splash | |
| Other Names | NAT18-437656 |