Systematic / IUPAC Name:
ID: Reference12990
Other Names: NAT38-536288
Formula: C13H19NO4S
N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(2-methylphenyl)cyclopentyl]methanesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2384 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/30/2024 5:48:21 PM |
| InChI | InChI=1S/C13H19NO4S/c1-8-5-3-4-6-9(8)10-7-11(15)13(16)12(10)14-19(2,17)18/h3-6,10-16H,7H2,1-2H3/t10-,11-,12-,13-/m1/s1 |
| InChI Key | HPBIHFVGKLXFER-FDYHWXHSSA-N |
| Canonical SMILES | CC1=CC=CC=C1C2CC(C(C2NS(=O)(=O)C)O)O |
| CAS | |
| Splash | |
| Other Names | NAT38-536288 |
| ChEMBL | CHEMBL4925601 |
| PubChem | 71693803 |
| ChemSpider | 29853005 |