Systematic / IUPAC Name: (1R,2S,3R,4R)-4-Phenyl-3-piperidin-1-ylcyclopentane-1,2-diol
ID: Reference12991
Other Names: NAT38-536476
Formula: C16H23NO2
(1R,2S,3R,4R)-4-Phenyl-3-(1-piperidinyl)-1,2-cyclopentanediol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 333 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/30/2024 5:50:14 PM |
| InChI | InChI=1S/C16H23NO2/c18-14-11-13(12-7-3-1-4-8-12)15(16(14)19)17-9-5-2-6-10-17/h1,3-4,7-8,13-16,18-19H,2,5-6,9-11H2/t13-,14-,15-,16-/m1/s1 |
| InChI Key | DAXXILONMIHHEV-KLHDSHLOSA-N |
| Canonical SMILES | C1CCN(CC1)C2C(CC(C2O)O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT38-536476 |