Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(3-methylphenyl)cyclopentyl]pyridine-3-carboxamide
ID: Reference12997
Other Names: NAT38-537556
Formula: C18H20N2O3
N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(3-methylphenyl)cyclopentyl]nicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1837 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/8/2024 10:47:15 AM |
| InChI | InChI=1S/C18H20N2O3/c1-11-4-2-5-12(8-11)14-9-15(21)17(22)16(14)20-18(23)13-6-3-7-19-10-13/h2-8,10,14-17,21-22H,9H2,1H3,(H,20,23)/t14-,15-,16-,17-/m1/s1 |
| InChI Key | URHCPFIWUXHMPF-QBPKDAKJSA-N |
| Canonical SMILES | CC1=CC(=CC=C1)C2CC(C(C2NC(=O)C3=CN=CC=C3)O)O |
| CAS | |
| Splash | |
| Other Names | NAT38-537556 |