Systematic / IUPAC Name: [(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-naphthalen-1-ylcarbamate
ID: Reference13009
Other Names: NAT13-337320
Formula: C21H26N2O2
[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl 1-naphthylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 634 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/13/2024 9:05:45 AM |
| InChI | InChI=1S/C21H26N2O2/c1-2-15-13-23-11-10-17(15)12-18(23)14-25-21(24)22-20-9-5-7-16-6-3-4-8-19(16)20/h3-9,15,17-18H,2,10-14H2,1H3,(H,22,24)/t15-,17-,18+/m0/s1 |
| InChI Key | HGWZSCZNOJQJHI-RYQLBKOJSA-N |
| Canonical SMILES | CCC1CN2CCC1CC2COC(=O)NC3=CC=CC4=CC=CC=C43 |
| CAS | |
| Splash | |
| Other Names | NAT13-337320 |