Systematic / IUPAC Name: 3-[[(3R,4S)-4-[2-[(2-Methoxyphenyl)methylamino]-2-oxoethyl]piperidin-3-yl]methyl]-1,2-oxazole-5-carboxylic acid
ID: Reference13010
Other Names: NAT14-262420
Formula: C20H25N3O5
3-{[(3R,4S)-4-{2-[(2-Methoxybenzyl)amino]-2-oxoethyl}-3-piperidinyl]methyl}-1,2-oxazole-5-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1401 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/13/2024 9:14:05 AM |
| InChI | InChI=1S/C20H25N3O5/c1-27-17-5-3-2-4-14(17)12-22-19(24)9-13-6-7-21-11-15(13)8-16-10-18(20(25)26)28-23-16/h2-5,10,13,15,21H,6-9,11-12H2,1H3,(H,22,24)(H,25,26)/t13-,15-/m0/s1 |
| InChI Key | WJAXOCKVIRMCPZ-ZFWWWQNUSA-N |
| Canonical SMILES | COC1=CC=CC=C1CNC(=O)CC2CCNCC2CC3=NOC(=C3)C(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT14-262420 |