Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-[6-(trifluoromethyl)pyridin-3-yl]cyclopentyl]-2-methylpropanamide
ID: Reference13016
Other Names: NAT38-539278
Formula: C15H19F3N2O3
N-{(1R,2S,3R,5R)-2,3-Dihydroxy-5-[6-(trifluoromethyl)-3-pyridinyl]cyclopentyl}-2-methylpropanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1510 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/15/2024 12:47:58 PM |
| InChI | InChI=1S/C15H19F3N2O3/c1-7(2)14(23)20-12-9(5-10(21)13(12)22)8-3-4-11(19-6-8)15(16,17)18/h3-4,6-7,9-10,12-13,21-22H,5H2,1-2H3,(H,20,23)/t9-,10-,12-,13-/m1/s1 |
| InChI Key | WNTZBDWRQCZBEP-FPQZTECRSA-N |
| Canonical SMILES | CC(C)C(=O)NC1C(CC(C1O)O)C2=CN=C(C=C2)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT38-539278 |