Systematic / IUPAC Name: (1R,2S,3R,4R)-4-(4-Methoxyphenyl)-3-(quinolin-3-ylmethylamino)cyclopentane-1,2-diol
ID: Reference13022
Other Names: NAT38-539551
Formula: C22H24N2O3
(1R,2S,3R,4R)-4-(4-Methoxyphenyl)-3-[(3-quinolinylmethyl)amino]-1,2-cyclopentanediol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1020 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/22/2024 8:52:15 AM |
| InChI | InChI=1S/C22H24N2O3/c1-27-17-8-6-15(7-9-17)18-11-20(25)22(26)21(18)24-13-14-10-16-4-2-3-5-19(16)23-12-14/h2-10,12,18,20-22,24-26H,11,13H2,1H3/t18-,20-,21-,22-/m1/s1 |
| InChI Key | HVLAZSKFCJBSJA-ZHHKINOHSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C2CC(C(C2NCC3=CC4=CC=CC=C4N=C3)O)O |
| CAS | |
| Splash | |
| Other Names | NAT38-539551 |