Systematic / IUPAC Name:
ID: Reference13029
Other Names: NAT47-553649
Formula: C13H16N2O2
3-{[(6R)-6-Hydroxy-1,4-oxazepan-4-yl]methyl}benzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 908 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/23/2024 1:23:42 PM |
| InChI | InChI=1S/C13H16N2O2/c14-7-11-2-1-3-12(6-11)8-15-4-5-17-10-13(16)9-15/h1-3,6,13,16H,4-5,8-10H2/t13-/m1/s1 |
| InChI Key | SMZVFSXGDCQZLT-CYBMUJFWSA-N |
| Canonical SMILES | C1COCC(CN1CC2=CC(=CC=C2)C#N)O |
| CAS | |
| Splash | |
| Other Names | NAT47-553649 |