Systematic / IUPAC Name: [5-[[(2S)-2-[3-[2-(2-Methoxyethoxy)pyridin-3-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methyl]furan-2-yl]methanol
ID: Reference13035
Other Names: NAT18-430248
Formula: C20H24N4O5
(5-{[(2S)-2-{3-[2-(2-Methoxyethoxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}-2-furyl)methanol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 160 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/26/2024 2:47:14 PM |
| InChI | InChI=1S/C20H24N4O5/c1-26-10-11-27-19-16(4-2-8-21-19)18-22-20(29-23-18)17-5-3-9-24(17)12-14-6-7-15(13-25)28-14/h2,4,6-8,17,25H,3,5,9-13H2,1H3/t17-/m0/s1 |
| InChI Key | SCGFMOTXVQXDQS-KRWDZBQOSA-N |
| Canonical SMILES | COCCOC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3CC4=CC=C(O4)CO |
| CAS | |
| Splash | |
| Other Names | NAT18-430248 |