Systematic / IUPAC Name: 2-Methyl-5-[[(1S,4S,5S)-2-methyl-5-propan-2-yl-4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]cyclohex-2-en-1-yl]methyl]-1,3,4-oxadiazole
ID: Reference13037
Other Names: NAT28-410281
Formula: C24H35N5O
1-({(1S,4S,6S)-6-Isopropyl-3-methyl-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-cyclohexen-1-yl}methyl)-4-(2-pyridinyl)piperazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1012 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/26/2024 2:51:49 PM |
| InChI | InChI=1S/C24H35N5O/c1-17(2)22-14-20(15-24-27-26-19(4)30-24)18(3)13-21(22)16-28-9-11-29(12-10-28)23-7-5-6-8-25-23/h5-8,13,17,20-22H,9-12,14-16H2,1-4H3/t20-,21-,22-/m0/s1 |
| InChI Key | ZXLPVAUSODRGBJ-FKBYEOEOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C)C(C)C)CN3CCN(CC3)C4=CC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT28-410281 |