Systematic / IUPAC Name: 1-[(1S,4S,6S)-3-Methyl-6-propan-2-yl-4-[(5-propyl-1,3,4-oxadiazol-2-yl)methyl]cyclohex-2-en-1-yl]-N-(pyridin-3-ylmethyl)methanamine
ID: Reference13038
Other Names: NAT28-413064
Formula: C23H34N4O
1-{(1S,4S,6S)-6-Isopropyl-3-methyl-4-[(5-propyl-1,3,4-oxadiazol-2-yl)methyl]-2-cyclohexen-1-yl}-N-(3-pyridinylmethyl)methanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2073 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/26/2024 2:56:14 PM |
| InChI | InChI=1S/C23H34N4O/c1-5-7-22-26-27-23(28-22)12-19-11-21(16(2)3)20(10-17(19)4)15-25-14-18-8-6-9-24-13-18/h6,8-10,13,16,19-21,25H,5,7,11-12,14-15H2,1-4H3/t19-,20-,21-/m0/s1 |
| InChI Key | WGWNEXHMUDGHFK-ACRUOGEOSA-N |
| Canonical SMILES | CCCC1=NN=C(O1)CC2CC(C(C=C2C)CNCC3=CN=CC=C3)C(C)C |
| CAS | |
| Splash | |
| Other Names | NAT28-413064 |