Systematic / IUPAC Name: 3-Methyl-3-buten-1-yl trihydrogen diphosphate
ID: Reference1304
Other Names:
3-Methyl-3-butenyl pyrophosphate;
Isopentenyl diphosphate;
δ-3-Isopentenyl pyrophosphate;
Isopentenyl pyrophosphic acid
Formula: C5H12O7P2
Class: Endogenous Metabolites
Isopentenyl pyrophosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 192 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2016 10:06:38 AM |
| InChI | InChI=1S/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h1,3-4H2,2H3,(H,9,10)(H2,6,7,8) |
| InChI Key | NUHSROFQTUXZQQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(=C)CCOP(=O)(O)OP(=O)(O)O |
| CAS | 358714 |
| Splash | |
| Other Names |
3-Methyl-3-butenyl pyrophosphate; Isopentenyl diphosphate; δ-3-Isopentenyl pyrophosphate; Isopentenyl pyrophosphic acid |
| ChemIDPlus | 000358714 |
| Wikipedia | Isopentenyl pyrophosphate |
| PubChem | 1195 |
| ChemSpider | 1158 |
| KEGG | C00129; C05847 |
| ChEBI | CHEBI:16584 |
| HMDb | HMDB01347 |
| ChEMBL | CHEMBL356362 |