Systematic / IUPAC Name:
ID: Reference13047
Other Names: NAT38-539020
Formula: C20H20F3NO3
N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(2-methylphenyl)cyclopentyl]-4-(trifluoromethyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1825 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/6/2024 11:27:54 AM |
| InChI | InChI=1S/C20H20F3NO3/c1-11-4-2-3-5-14(11)15-10-16(25)18(26)17(15)24-19(27)12-6-8-13(9-7-12)20(21,22)23/h2-9,15-18,25-26H,10H2,1H3,(H,24,27)/t15-,16-,17-,18-/m1/s1 |
| InChI Key | NKQFIGVCOCKIAF-BRSBDYLESA-N |
| Canonical SMILES | CC1=CC=CC=C1C2CC(C(C2NC(=O)C3=CC=C(C=C3)C(F)(F)F)O)O |
| CAS | |
| Splash | |
| Other Names | NAT38-539020 |