Systematic / IUPAC Name: (1S,2R,18S,22S)-2-Hydroxy-8-morpholin-4-yl-4,21-dioxa-12,15-diazatetracyclo[13.6.2.05,10.018,22]tricosa-5(10),6,8-triene-14,20-dione
ID: Reference13078
Other Names: MC14-346537
Formula: C23H31N3O6
(1S,2R,18S,22S)-2-Hydroxy-8-(4-morpholinyl)-4,21-dioxa-12,15-diazatetracyclo[13.6.2.05,10 018,22]tricosa-5,7,9-triene-14,20-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1041 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/25/2024 4:56:05 PM |
| InChI | InChI=1S/C23H31N3O6/c27-19-14-31-20-2-1-17(25-5-7-30-8-6-25)9-16(20)11-24-12-21(28)26-4-3-15-10-22(29)32-23(19)18(15)13-26/h1-2,9,15,18-19,23-24,27H,3-8,10-14H2/t15-,18+,19+,23-/m0/s1 |
| InChI Key | IZVGRVVOPUEBCN-LONFEIEESA-N |
| Canonical SMILES | C1CN2CC3C1CC(=O)OC3C(COC4=C(CNCC2=O)C=C(C=C4)N5CCOCC5)O |
| CAS | |
| Splash | |
| Other Names | MC14-346537 |