Systematic / IUPAC Name: 2-O-Sulfo-L-threo-hex-1-enofuranos-3-ulose
ID: Reference1310
Other Names:
Ascorbic acid 2-sulfate;
L-Ascorbyl-2-sulfate ;
Ascorbate 2-sulfate
Formula: C6H8O9S
Class: Endogenous Metabolites
L-Ascorbic acid 2-sulfate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 218 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2016 10:18:28 AM |
| InChI | InChI=1S/C6H8O9S/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13/h2,4,7-9H,1H2,(H,11,12,13)/t2-,4+/m0/s1 |
| InChI Key | XDBMXUKHMOFBPJ-ZAFYKAAXSA-N |
| Canonical SMILES | C(C(C1C(=C(C(=O)O1)OS(=O)(=O)O)O)O)O |
| CAS | 37627955 |
| Splash | |
| Other Names |
Ascorbic acid 2-sulfate; L-Ascorbyl-2-sulfate ; Ascorbate 2-sulfate |