Systematic / IUPAC Name: (2R)-N-[(2S)-1-Amino-3-cyclohexyl-1-oxopropan-2-yl]-1-(benzenesulfonyl)piperazine-2-carboxamide
ID: Reference13111
Other Names: NAT9-312707
Formula: C20H30N4O4S
(2R)-N-[(2S)-1-Amino-3-cyclohexyl-1-oxo-2-propanyl]-1-(phenylsulfonyl)-2-piperazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1485 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/19/2024 3:04:06 PM |
| InChI | InChI=1S/C20H30N4O4S/c21-19(25)17(13-15-7-3-1-4-8-15)23-20(26)18-14-22-11-12-24(18)29(27,28)16-9-5-2-6-10-16/h2,5-6,9-10,15,17-18,22H,1,3-4,7-8,11-14H2,(H2,21,25)(H,23,26)/t17-,18+/m0/s1 |
| InChI Key | VIHWDVDECOBFGQ-ZWKOTPCHSA-N |
| Canonical SMILES | C1CCC(CC1)CC(C(=O)N)NC(=O)C2CNCCN2S(=O)(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT9-312707 |