Systematic / IUPAC Name: 2-[(3R,4S)-3-[2-(4-Acetylpiperazin-1-yl)ethyl]-1-(2-phenylacetyl)piperidin-4-yl]acetic acid
ID: Reference13125
Other Names: NAT14-336407
Formula: C23H33N3O4
[(3R,4S)-3-[2-(4-Acetyl-1-piperazinyl)ethyl]-1-(phenylacetyl)-4-piperidinyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1770 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/3/2024 12:01:36 PM |
| InChI | InChI=1S/C23H33N3O4/c1-18(27)25-13-11-24(12-14-25)9-7-21-17-26(10-8-20(21)16-23(29)30)22(28)15-19-5-3-2-4-6-19/h2-6,20-21H,7-17H2,1H3,(H,29,30)/t20-,21-/m0/s1 |
| InChI Key | UNBMZEUWLGZDHF-SFTDATJTSA-N |
| Canonical SMILES | CC(=O)N1CCN(CC1)CCC2CN(CCC2CC(=O)O)C(=O)CC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT14-336407 |