Systematic / IUPAC Name: Methyl 1-[2-[(3R,4S)-3-ethyl-1-(propan-2-ylcarbamoyl)piperidin-4-yl]acetyl]piperidine-4-carboxylate
ID: Reference13148
Other Names: NAT14-323573
Formula: C20H35N3O4
Methyl 1-{[(3R,4S)-3-ethyl-1-(isopropylcarbamoyl)-4-piperidinyl]acetyl}-4-piperidinecarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1454 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/24/2024 4:04:39 PM |
| InChI | InChI=1S/C20H35N3O4/c1-5-15-13-23(20(26)21-14(2)3)11-8-17(15)12-18(24)22-9-6-16(7-10-22)19(25)27-4/h14-17H,5-13H2,1-4H3,(H,21,26)/t15-,17-/m0/s1 |
| InChI Key | BILNECDTNLBWRQ-RDJZCZTQSA-N |
| Canonical SMILES | CCC1CN(CCC1CC(=O)N2CCC(CC2)C(=O)OC)C(=O)NC(C)C |
| CAS | |
| Splash | |
| Other Names | NAT14-323573 |