Systematic / IUPAC Name:
ID: Reference13151
Other Names: 3,4,5OMe-GL-9Akr
Formula: C35H29N3O7S
2-(4-{[(5Z)-3-[(Acridin-9-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl}phenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4103 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/24/2024 4:36:15 PM |
| InChI | InChI=1S/C35H29N3O7S/c1-42-29-17-22(18-30(43-2)33(29)44-3)36-32(39)20-45-23-14-12-21(13-15-23)16-31-34(40)38(35(41)46-31)19-26-24-8-4-6-10-27(24)37-28-11-7-5-9-25(26)28/h4-18H,19-20H2,1-3H3,(H,36,39)/b31-16- |
| InChI Key | GEGBIWCOCFRVGE-ACXHZZMFSA-N |
| Canonical SMILES | O=C1S\C(=C/c2ccc(OCC(=O)Nc3cc(OC)c(OC)c(OC)c3)cc2)C(=O)N1Cc1c2ccccc2nc2ccccc12 |
| CAS | |
| Splash | |
| Other Names | 3,4,5OMe-GL-9Akr |