Systematic / IUPAC Name:
ID: Reference13152
Other Names: 4NO2-GL-9Akr
Formula: C32H22N4O6S
2-(4-{[(5Z)-3-[(Acridin-9-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl}phenoxy)-N-(4-nitrophenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2788 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/24/2024 4:38:54 PM |
| InChI | InChI=1S/C32H22N4O6S/c37-30(33-21-11-13-22(14-12-21)36(40)41)19-42-23-15-9-20(10-16-23)17-29-31(38)35(32(39)43-29)18-26-24-5-1-3-7-27(24)34-28-8-4-2-6-25(26)28/h1-17H,18-19H2,(H,33,37)/b29-17- |
| InChI Key | HOOWYYOYRNZXKG-RHANQZHGSA-N |
| Canonical SMILES | O=C1S\C(=C/c2ccc(OCC(=O)Nc3ccc(cc3)N(=O)=O)cc2)C(=O)N1Cc1c2ccccc2nc2ccccc12 |
| CAS | |
| Splash | |
| Other Names | 4NO2-GL-9Akr |