Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[2-[(4-Cyanophenyl)methylamino]-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]-3-methoxypropanamide
ID: Reference13154
Other Names: NAT28-408356
Formula: C25H35N3O3
N-{[(1S,4S,6S)-4-{2-[(4-Cyanobenzyl)amino]-2-oxoethyl}-6-isopropyl-3-methyl-2-cyclohexen-1-yl]methyl}-3-methoxypropanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3085 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/24/2024 3:48:56 PM |
| InChI | InChI=1S/C25H35N3O3/c1-17(2)23-12-21(18(3)11-22(23)16-28-24(29)9-10-31-4)13-25(30)27-15-20-7-5-19(14-26)6-8-20/h5-8,11,17,21-23H,9-10,12-13,15-16H2,1-4H3,(H,27,30)(H,28,29)/t21-,22-,23-/m0/s1 |
| InChI Key | STQLXKQMWZYICQ-VABKMULXSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NCC2=CC=C(C=C2)C#N)C(C)C)CNC(=O)CCOC |
| CAS | |
| Splash | |
| Other Names | NAT28-408356 |