Systematic / IUPAC Name:
ID: Reference13167
Other Names: 3,4,5OMe-van-GL-9Akr
Formula: C36H31N3O8S
2-(4-{[(5Z)-3-[(Acridin-9-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl}-2-methoxyphenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2871 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/3/2024 3:34:30 PM |
| InChI | InChI=1S/C36H31N3O8S/c1-43-29-15-21(13-14-28(29)47-20-33(40)37-22-17-30(44-2)34(46-4)31(18-22)45-3)16-32-35(41)39(36(42)48-32)19-25-23-9-5-7-11-26(23)38-27-12-8-6-10-24(25)27/h5-18H,19-20H2,1-4H3,(H,37,40)/b32-16- |
| InChI Key | UUAUSQNWEJDCJI-ZMGVVAQMSA-N |
| Canonical SMILES | O=C1S\C(=C/c2ccc(OCC(=O)Nc3cc(OC)c(OC)c(OC)c3)c(OC)c2)C(=O)N1Cc1c2ccccc2nc2ccccc12 |
| CAS | |
| Splash | |
| Other Names | 3,4,5OMe-van-GL-9Akr |