Systematic / IUPAC Name:
ID: Reference13170
Other Names: 3,5CF3-GL-4Akr
Formula: C34H21F6N3O4S
2-(4-{[(5Z)-3-[(Acridin-4-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl}-2-methoxyphenoxy)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2936 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/3/2024 3:45:00 PM |
| InChI | InChI=1S/C34H21F6N3O4S/c35-33(36,37)23-14-24(34(38,39)40)16-25(15-23)41-29(44)18-47-26-10-8-19(9-11-26)12-28-31(45)43(32(46)48-28)17-22-6-3-5-21-13-20-4-1-2-7-27(20)42-30(21)22/h1-16H,17-18H2,(H,41,44)/b28-12- |
| InChI Key | FRLAWQDPOUECDC-NVJOKUIPSA-N |
| Canonical SMILES | O=C1S\C(=C/c2ccc(OCC(=O)Nc3cc(cc(c3)C(F)(F)F)C(F)(F)F)cc2)C(=O)N1Cc1cccc2cc3ccccc3nc12 |
| CAS | |
| Splash | |
| Other Names | 3,5CF3-GL-4Akr |