Systematic / IUPAC Name:
ID: Reference13178
Other Names: DHI-3
Formula: C19H18N2O3
3-Methoxy-2-[5-(1-methyl-1H-indol-3-yl)-4,5-dihydro-1,2-oxazol-3-yl]phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2615 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/13/2024 8:38:52 AM |
| InChI | InChI=1S/C19H18N2O3/c1-21-11-13(12-6-3-4-7-15(12)21)18-10-14(20-24-18)19-16(22)8-5-9-17(19)23-2/h3-9,11,18,22H,10H2,1-2H3 |
| InChI Key | GMNIYCSWZDKYNK-UHFFFAOYSA-N |
| Canonical SMILES | Cn1cc(C2CC(=NO2)c2c(cccc2O)OC)c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | DHI-3 |