Systematic / IUPAC Name: N-Benzyl-N-[3-(2-methylpropoxy)-2-pyrrolidin-1-ylpropyl]aniline
ID: Reference1318
Other Names:
Bepadin;
β-[(2-Methylpropoxy)methyl]-N-phenyl-N-(phenylmethyl)-1-pyrrolidineethanamine ;
N-{3-[(2-Methylpropyl)oxy]-2-pyrrolidin-1-ylpropyl}-N-(phenylmethyl)aniline;
N-Benzyl-N-[3-isobutoxy-2-(pyrrolidin-1-yl)propyl]aniline ;
1-Pyrrolidineethanamine, β-[(2-methylpropoxy)methyl]-N-phenyl-N-(phenylmethyl)-
Formula: C24H34N2O
Class: Therapeutics/Prescription Drugs
Bepridil mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 116 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2016 10:25:25 AM |
| InChI | InChI=1S/C24H34N2O/c1-21(2)19-27-20-24(25-15-9-10-16-25)18-26(23-13-7-4-8-14-23)17-22-11-5-3-6-12-22/h3-8,11-14,21,24H,9-10,15-20H2,1-2H3 |
| InChI Key | UIEATEWHFDRYRU-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)COCC(CN(CC1=CC=CC=C1)C2=CC=CC=C2)N3CCCC3 |
| CAS | 49571042 |
| Splash | |
| Other Names |
Bepadin; β-[(2-Methylpropoxy)methyl]-N-phenyl-N-(phenylmethyl)-1-pyrrolidineethanamine ; N-{3-[(2-Methylpropyl)oxy]-2-pyrrolidin-1-ylpropyl}-N-(phenylmethyl)aniline; N-Benzyl-N-[3-isobutoxy-2-(pyrrolidin-1-yl)propyl]aniline ; 1-Pyrrolidineethanamine, β-[(2-methylpropoxy)methyl]-N-phenyl-N-(phenylmethyl)- |
| ChEBI | CHEBI:3061 |
| ChemSpider | 2261 |
| PubChem | 2351 |
| Wikipedia | Bepridil |
| KEGG | C06847; D07520 |
| DrugBank | APRD00727 |
| ChemIDPlus | 064706543 |
| ChEMBL | CHEMBL1008 |