Systematic / IUPAC Name:
ID: Reference13202
Other Names: 4NO2-van-GL-4Akr
Formula: C33H24N4O7S
2-(4-{[(5Z)-3-[(Acridin-4-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl}-2-methoxyphenoxy)-N-(4-nitrophenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2824 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/24/2024 11:46:39 AM |
| InChI | InChI=1S/C33H24N4O7S/c1-43-28-15-20(9-14-27(28)44-19-30(38)34-24-10-12-25(13-11-24)37(41)42)16-29-32(39)36(33(40)45-29)18-23-7-4-6-22-17-21-5-2-3-8-26(21)35-31(22)23/h2-17H,18-19H2,1H3,(H,34,38)/b29-16- |
| InChI Key | KNSXUPJPZRTFGN-MWLSYYOVSA-N |
| Canonical SMILES | O=C1S\C(=C/c2ccc(OCC(=O)Nc3ccc(cc3)N(=O)=O)c(OC)c2)C(=O)N1Cc1cccc2cc3ccccc3nc12 |
| CAS | |
| Splash | |
| Other Names | 4NO2-van-GL-4Akr |