Systematic / IUPAC Name:
ID: Reference13207
Other Names: DHI-7
Formula: C20H20N2O4
3-[3-(3,4,5-Trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD ; Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 4 |
| No. of Spectra | 5366 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/1/2024 7:57:26 AM |
| InChI | InChI=1S/C20H20N2O4/c1-23-18-8-12(9-19(24-2)20(18)25-3)16-10-17(26-22-16)14-11-21-15-7-5-4-6-13(14)15/h4-9,11,17,21H,10H2,1-3H3 |
| InChI Key | YLUDPNJHUCWRDC-UHFFFAOYSA-N |
| Canonical SMILES | COc1cc(cc(OC)c1OC)C=1CC(ON=1)c1c[NH]c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | DHI-7 |