Systematic / IUPAC Name:
ID: Reference13215
Other Names: KT-2
Formula: C21H21NO5
(2E)-3-(1-Methoxy-1H-indol-3-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3458 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/8/2024 9:52:44 AM |
| InChI | InChI=1S/C21H21NO5/c1-24-19-11-15(12-20(25-2)21(19)26-3)18(23)10-9-14-13-22(27-4)17-8-6-5-7-16(14)17/h5-13H,1-4H3/b10-9+ |
| InChI Key | XHPBMTMLIDNTDQ-MDZDMXLPSA-N |
| Canonical SMILES | COc1cc(cc(OC)c1OC)C(=O)/C=C/c1cn(OC)c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | KT-2 |