Systematic / IUPAC Name:
ID: Reference13216
Other Names: KT-3
Formula: C20H19NO4
(2E)-3-(1H-Indol-3-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2320 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/8/2024 9:54:39 AM |
| InChI | InChI=1S/C20H19NO4/c1-23-18-10-14(11-19(24-2)20(18)25-3)17(22)9-8-13-12-21-16-7-5-4-6-15(13)16/h4-12,21H,1-3H3/b9-8+ |
| InChI Key | QJHGHTUUBIGVAG-CMDGGOBGSA-N |
| Canonical SMILES | COc1cc(cc(OC)c1OC)C(=O)/C=C/c1c[NH]c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | KT-3 |