Systematic / IUPAC Name:
ID: Reference13217
Other Names: KT-4
Formula: C22H23NO5
(2E)-3-(2-Ethoxy-1H-indol-3-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4895 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/8/2024 9:57:15 AM |
| InChI | InChI=1S/C22H23NO5/c1-5-28-22-16(15-8-6-7-9-17(15)23-22)10-11-18(24)14-12-19(25-2)21(27-4)20(13-14)26-3/h6-13,23H,5H2,1-4H3/b11-10+ |
| InChI Key | PYNMQKZVSGOSJX-ZHACJKMWSA-N |
| Canonical SMILES | COc1cc(cc(OC)c1OC)C(=O)/C=C/c1c2ccccc2[NH]c1OCC |
| CAS | |
| Splash | |
| Other Names | KT-4 |