Systematic / IUPAC Name:
ID: Reference13229
Other Names: H-CHL-9van-1H
Formula: C18H15NO3
(2E)-3-(3-Hydroxy-4-methoxyphenyl)-1-(1H-indol-3-yl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 4 |
| No. of Spectra | 3757 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2024 10:36:25 AM |
| InChI | InChI=1S/C18H15NO3/c1-22-18-9-7-12(10-17(18)21)6-8-16(20)14-11-19-15-5-3-2-4-13(14)15/h2-11,19,21H,1H3/b8-6+ |
| InChI Key | JJJRAVUDAOIJDJ-SOFGYWHQSA-N |
| Canonical SMILES | COc1ccc(cc1O)/C=C/C(=O)c1c[NH]c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | H-CHL-9van-1H |