Systematic / IUPAC Name:
ID: Reference13231
Other Names: 3,4,5OMe-CHO
Formula: C18H19NO6
2-(4-Formylphenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3540 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2024 10:53:23 AM |
| InChI | InChI=1S/C18H19NO6/c1-22-15-8-13(9-16(23-2)18(15)24-3)19-17(21)11-25-14-6-4-12(10-20)5-7-14/h4-10H,11H2,1-3H3,(H,19,21) |
| InChI Key | WFXUYGKJMQCASU-UHFFFAOYSA-N |
| Canonical SMILES | COc1c(cc(cc1OC)NC(=O)COc1ccc(C=O)cc1)OC |
| CAS | |
| Splash | |
| Other Names | 3,4,5OMe-CHO |