Systematic / IUPAC Name:
ID: Reference13238
Other Names: 3,5CF3-CHO
Formula: C17H11F6NO3
N-[3,5-bis(Trifluoromethyl)phenyl]-2-(4-formylphenoxy)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2808 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/29/2024 10:23:16 AM |
| InChI | InChI=1S/C17H11F6NO3/c18-16(19,20)11-5-12(17(21,22)23)7-13(6-11)24-15(26)9-27-14-3-1-10(8-25)2-4-14/h1-8H,9H2,(H,24,26) |
| InChI Key | XCLKFQMWLMJWKX-UHFFFAOYSA-N |
| Canonical SMILES | FC(F)(F)c1cc(cc(c1)C(F)(F)F)NC(=O)COc1ccc(cc1)C=O |
| CAS | |
| Splash | |
| Other Names | 3,5CF3-CHO |