Systematic / IUPAC Name:
ID: Reference13254
Other Names: 4-NO2-TZD
Formula: C18H13N3O6S
2-{4-[(Z)-(2,4-Dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy}-N-(4-nitrophenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3761 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/27/2024 9:57:31 AM |
| InChI | InChI=1S/C18H13N3O6S/c22-16(19-12-3-5-13(6-4-12)21(25)26)10-27-14-7-1-11(2-8-14)9-15-17(23)20-18(24)28-15/h1-9H,10H2,(H,19,22)(H,20,23,24)/b15-9- |
| InChI Key | CGFXKUHDOBLVOB-DHDCSXOGSA-N |
| Canonical SMILES | O=C1NC(=O)S/C1=C\c1ccc(OCC(=O)Nc2ccc(cc2)N(=O)=O)cc1 |
| CAS | |
| Splash | |
| Other Names | 4-NO2-TZD |