Systematic / IUPAC Name:
ID: Reference13257
Other Names: Me-CH-L9-(3OH,4-MeO-1Me)
Formula: C19H17NO3
(2E)-3-(3-Hydroxy-4-methoxyphenyl)-1-(1-methyl-1H-indol-3-yl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1816 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/27/2024 10:12:56 AM |
| InChI | InChI=1S/C19H17NO3/c1-20-12-15(14-5-3-4-6-16(14)20)17(21)9-7-13-8-10-19(23-2)18(22)11-13/h3-12,22H,1-2H3/b9-7+ |
| InChI Key | QDXRXOIRQZICPB-VQHVLOKHSA-N |
| Canonical SMILES | COc1ccc(cc1O)/C=C/C(=O)c1cn(C)c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | Me-CH-L9-(3OH,4-MeO-1Me) |