Systematic / IUPAC Name: Methyl (4-hydroxyphenyl)acetate
ID: Reference1326
Other Names:
4-Hydroxyphenylacetic acid methyl ester;
Benzeneacetic acid, 4-hydroxy-, methyl ester;
Acetic acid, (p-hydroxyphenyl), methyl ester
Formula: C9H10O3
Methyl 4-hydroxyphenylacetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 156 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 9:46:20 AM |
| InChI | InChI=1S/C9H10O3/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-5,10H,6H2,1H3 |
| InChI Key | XGDZEDRBLVIUMX-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)CC1=CC=C(C=C1)O |
| CAS | 14199156 |
| Splash | |
| Other Names |
4-Hydroxyphenylacetic acid methyl ester; Benzeneacetic acid, 4-hydroxy-, methyl ester; Acetic acid, (p-hydroxyphenyl), methyl ester |
| ChemSpider | 452661 |
| PubChem | 518900 |
| ChEBI | CHEBI:68078 |
| ChemIDPlus | 014199156 |