Systematic / IUPAC Name: 1,2,2,3,3,4,5,5,6,6-Decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonic acid
ID: Reference13263
Other Names: AA-1594
Formula: C8HF15O3S
Class: Perfluorinated Hydrocarbons
Perfluoro-4-ethylcyclohexane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 260 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/2/2024 1:46:55 PM |
| InChI | InChI=1S/C8HF15O3S/c9-1(4(14,15)8(21,22)23)2(10,11)5(16,17)7(20,27(24,25)26)6(18,19)3(1,12)13/h(H,24,25,26) |
| InChI Key | ICKAEAFPESRWOT-UHFFFAOYSA-N |
| Canonical SMILES | C1(C(C(C(C(C1(F)F)(F)F)(F)S(=O)(=O)O)(F)F)(F)F)(C(C(F)(F)F)(F)F)F |
| CAS | |
| Splash | |
| Other Names | AA-1594 |
| PubChem | 101650 |