Systematic / IUPAC Name:
ID: Reference13271
Other Names: Me-CH-16-(1Me-3,4-diF)
Formula: C18H13F2NO
(2E)-1-(3,4-Difluorophenyl)-3-(1-methyl-1H-indol-3-yl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 984 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/16/2024 10:22:37 AM |
| InChI | InChI=1S/C18H13F2NO/c1-21-11-13(14-4-2-3-5-17(14)21)7-9-18(22)12-6-8-15(19)16(20)10-12/h2-11H,1H3/b9-7+ |
| InChI Key | BNXQEEWPOMJSGH-VQHVLOKHSA-N |
| Canonical SMILES | Fc1ccc(cc1F)C(=O)/C=C/c1cn(C)c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | Me-CH-16-(1Me-3,4-diF) |