Systematic / IUPAC Name: 1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-Hexadecafluoro-7-(trifluoromethyl)octane-1-sulfonic acid
ID: Reference13273
Other Names: AA-1598
Formula: C9HF19O3S
Class: Perfluorinated Hydrocarbons
Perfluoro(7-methyl-1-octanesulfonic acid) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 160 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/20/2024 10:35:03 AM |
| InChI | InChI=1S/C9HF19O3S/c10-1(7(21,22)23,8(24,25)26)2(11,12)3(13,14)4(15,16)5(17,18)6(19,20)9(27,28)32(29,30)31/h(H,29,30,31) |
| InChI Key | URKPVRNLWSKUDD-UHFFFAOYSA-N |
| Canonical SMILES | C(C(C(C(C(C(C(F)(F)S(=O)(=O)O)(F)F)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)F |
| CAS | |
| Splash | |
| Other Names | AA-1598 |
| PubChem | 102026481 |