Systematic / IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,8,8,8-Tetradecafluoro-7-(trifluoromethyl)octanoic acid
ID: Reference13275
Other Names: AA-1600
Formula: C9HF17O2
Class: Perfluorinated Hydrocarbons
Tetradecafluoro-7-(trifluoromethyl)octanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 395 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/20/2024 10:36:48 AM |
| InChI | InChI=1S/C9HF17O2/c10-2(11,1(27)28)4(13,14)6(17,18)7(19,20)5(15,16)3(12,8(21,22)23)9(24,25)26/h(H,27,28) |
| InChI Key | WIXVASFEKZIRFM-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| CAS | |
| Splash | |
| Other Names | AA-1600 |
| PubChem | 85176 |